C17H25N3O — CID 104694105
2-[2-aminoethyl(benzyl)amino]-N,N-bis(prop-2-enyl)acetamide (PubChem CID 104694105) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[2-aminoethyl(benzyl)amino]-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-[2-aminoethyl(benzyl)amino]-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 104694105 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 2-[2-aminoethyl(benzyl)amino]-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)CN(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C17H25N3O/c1-3-11-20(12-4-2)17(21)15-19(13-10-18)14-16-8-6-5-7-9-16/h3-9H,1-2,10-15,18H2 |
| InChIKey | CUOVFDNOTHUEIS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|