C27H30N2O — CID 10949354
N,N-dibenzyl-2-[benzyl(but-3-enyl)amino]acetamide (PubChem CID 10949354) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is N,N-dibenzyl-2-[benzyl(but-3-enyl)amino]acetamide.
| Compound Name | N,N-dibenzyl-2-[benzyl(but-3-enyl)amino]acetamide |
|---|---|
| PubChem CID | 10949354 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | N,N-dibenzyl-2-[benzyl(but-3-enyl)amino]acetamide |
| SMILES | C=CCCN(CC(=O)N(Cc1ccccc1)Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H30N2O/c1-2-3-19-28(20-24-13-7-4-8-14-24)23-27(30)29(21-25-15-9-5-10-16-25)22-26-17-11-6-12-18-26/h2,4-18H,1,3,19-23H2 |
| InChIKey | GGWYDOKAXDHNLI-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|