About thiocyanatomethyl prop-2-enylsulfanylformate
thiocyanatomethyl prop-2-enylsulfanylformate (PubChem CID 88788817) has the molecular formula C6H7NO2S2
and a molecular weight of 189.26 g/mol. Its IUPAC name is thiocyanatomethyl prop-2-enylsulfanylformate.
Molecular Properties
| Compound Name | thiocyanatomethyl prop-2-enylsulfanylformate |
| PubChem CID | 88788817 |
| Molecular Formula | C6H7NO2S2 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | thiocyanatomethyl prop-2-enylsulfanylformate |
| SMILES | C=CCSC(=O)OCSC#N |
| InChI | InChI=1S/C6H7NO2S2/c1-2-3-11-6(8)9-5-10-4-7/h2H,1,3,5H2 |
| InChIKey | MCXHNNAZRVGPMW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze thiocyanatomethyl prop-2-enylsulfanylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiocyanatomethyl prop-2-enylsulfanylformate?
The IUPAC name of thiocyanatomethyl prop-2-enylsulfanylformate (CID 88788817) is thiocyanatomethyl prop-2-enylsulfanylformate.
What is the SMILES notation for thiocyanatomethyl prop-2-enylsulfanylformate?
The canonical SMILES for thiocyanatomethyl prop-2-enylsulfanylformate is C=CCSC(=O)OCSC#N.
What is the InChIKey of thiocyanatomethyl prop-2-enylsulfanylformate?
The InChIKey is MCXHNNAZRVGPMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S2/c1-2-3-11-6(8)9-5-10-4-7/h2H,1,3,5H2.
What are the key properties of thiocyanatomethyl prop-2-enylsulfanylformate?
thiocyanatomethyl prop-2-enylsulfanylformate has a molecular weight of 189.26 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for thiocyanatomethyl prop-2-enylsulfanylformate is sourced from PubChem (CID 88788817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).