About 3-thiocyanatopropyl acetate
3-thiocyanatopropyl acetate (PubChem CID 10820856) has the molecular formula C6H9NO2S
and a molecular weight of 159.21 g/mol. Its IUPAC name is 3-thiocyanatopropyl acetate.
Molecular Properties
| Compound Name | 3-thiocyanatopropyl acetate |
| PubChem CID | 10820856 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 3-thiocyanatopropyl acetate |
| SMILES | CC(=O)OCCCSC#N |
| InChI | InChI=1S/C6H9NO2S/c1-6(8)9-3-2-4-10-5-7/h2-4H2,1H3 |
| InChIKey | SCVLYKODWVFHEE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-thiocyanatopropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiocyanatopropyl acetate?
The IUPAC name of 3-thiocyanatopropyl acetate (CID 10820856) is 3-thiocyanatopropyl acetate.
What is the SMILES notation for 3-thiocyanatopropyl acetate?
The canonical SMILES for 3-thiocyanatopropyl acetate is CC(=O)OCCCSC#N.
What is the InChIKey of 3-thiocyanatopropyl acetate?
The InChIKey is SCVLYKODWVFHEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2S/c1-6(8)9-3-2-4-10-5-7/h2-4H2,1H3.
What are the key properties of 3-thiocyanatopropyl acetate?
3-thiocyanatopropyl acetate has a molecular weight of 159.21 g/mol, XLogP of 1.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiocyanatopropyl acetate is sourced from PubChem (CID 10820856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).