About 6-thiocyanatohexyl butanoate
6-thiocyanatohexyl butanoate (PubChem CID 129069436) has the molecular formula C11H19NO2S
and a molecular weight of 229.34 g/mol. Its IUPAC name is 6-thiocyanatohexyl butanoate.
Molecular Properties
| Compound Name | 6-thiocyanatohexyl butanoate |
| PubChem CID | 129069436 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 6-thiocyanatohexyl butanoate |
| SMILES | CCCC(=O)OCCCCCCSC#N |
| InChI | InChI=1S/C11H19NO2S/c1-2-7-11(13)14-8-5-3-4-6-9-15-10-12/h2-9H2,1H3 |
| InChIKey | YRRYHKQYFVQLQD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-thiocyanatohexyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiocyanatohexyl butanoate?
The IUPAC name of 6-thiocyanatohexyl butanoate (CID 129069436) is 6-thiocyanatohexyl butanoate.
What is the SMILES notation for 6-thiocyanatohexyl butanoate?
The canonical SMILES for 6-thiocyanatohexyl butanoate is CCCC(=O)OCCCCCCSC#N.
What is the InChIKey of 6-thiocyanatohexyl butanoate?
The InChIKey is YRRYHKQYFVQLQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2S/c1-2-7-11(13)14-8-5-3-4-6-9-15-10-12/h2-9H2,1H3.
What are the key properties of 6-thiocyanatohexyl butanoate?
6-thiocyanatohexyl butanoate has a molecular weight of 229.34 g/mol, XLogP of 3.10, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiocyanatohexyl butanoate is sourced from PubChem (CID 129069436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).