About S-prop-2-enyl 2-aminobenzenecarbothioate
S-prop-2-enyl 2-aminobenzenecarbothioate (PubChem CID 88781587) has the molecular formula C10H11NOS
and a molecular weight of 193.27 g/mol. Its IUPAC name is S-prop-2-enyl 2-aminobenzenecarbothioate.
Molecular Properties
| Compound Name | S-prop-2-enyl 2-aminobenzenecarbothioate |
| PubChem CID | 88781587 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | S-prop-2-enyl 2-aminobenzenecarbothioate |
| SMILES | C=CCSC(=O)c1ccccc1N |
| InChI | InChI=1S/C10H11NOS/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h2-6H,1,7,11H2 |
| InChIKey | SUIGHGUOYAIMPC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-prop-2-enyl 2-aminobenzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-prop-2-enyl 2-aminobenzenecarbothioate?
The IUPAC name of S-prop-2-enyl 2-aminobenzenecarbothioate (CID 88781587) is S-prop-2-enyl 2-aminobenzenecarbothioate.
What is the SMILES notation for S-prop-2-enyl 2-aminobenzenecarbothioate?
The canonical SMILES for S-prop-2-enyl 2-aminobenzenecarbothioate is C=CCSC(=O)c1ccccc1N.
What is the InChIKey of S-prop-2-enyl 2-aminobenzenecarbothioate?
The InChIKey is SUIGHGUOYAIMPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NOS/c1-2-7-13-10(12)8-5-3-4-6-9(8)11/h2-6H,1,7,11H2.
What are the key properties of S-prop-2-enyl 2-aminobenzenecarbothioate?
S-prop-2-enyl 2-aminobenzenecarbothioate has a molecular weight of 193.27 g/mol, XLogP of 2.33, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-prop-2-enyl 2-aminobenzenecarbothioate is sourced from PubChem (CID 88781587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).