About prop-2-enyl 2-(2-aminophenyl)acetate
prop-2-enyl 2-(2-aminophenyl)acetate (PubChem CID 67741343) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is prop-2-enyl 2-(2-aminophenyl)acetate.
Molecular Properties
| Compound Name | prop-2-enyl 2-(2-aminophenyl)acetate |
| PubChem CID | 67741343 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | prop-2-enyl 2-(2-aminophenyl)acetate |
| SMILES | C=CCOC(=O)Cc1ccccc1N |
| InChI | InChI=1S/C11H13NO2/c1-2-7-14-11(13)8-9-5-3-4-6-10(9)12/h2-6H,1,7-8,12H2 |
| InChIKey | XURHLBOMKMKGOR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-(2-aminophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-(2-aminophenyl)acetate?
The IUPAC name of prop-2-enyl 2-(2-aminophenyl)acetate (CID 67741343) is prop-2-enyl 2-(2-aminophenyl)acetate.
What is the SMILES notation for prop-2-enyl 2-(2-aminophenyl)acetate?
The canonical SMILES for prop-2-enyl 2-(2-aminophenyl)acetate is C=CCOC(=O)Cc1ccccc1N.
What is the InChIKey of prop-2-enyl 2-(2-aminophenyl)acetate?
The InChIKey is XURHLBOMKMKGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-7-14-11(13)8-9-5-3-4-6-10(9)12/h2-6H,1,7-8,12H2.
What are the key properties of prop-2-enyl 2-(2-aminophenyl)acetate?
prop-2-enyl 2-(2-aminophenyl)acetate has a molecular weight of 191.23 g/mol, XLogP of 1.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-(2-aminophenyl)acetate is sourced from PubChem (CID 67741343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).