C36H40O8Si6 — CID 177446580
1,3,7,9-tetraphenyl-5,5,11,11-tetrakis(prop-2-enyl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane (PubChem CID 177446580) has the molecular formula C36H40O8Si6 and a molecular weight of 769.22 g/mol. Its IUPAC name is 1,3,7,9-tetraphenyl-5,5,11,11-tetrakis(prop-2-enyl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane.
| Compound Name | 1,3,7,9-tetraphenyl-5,5,11,11-tetrakis(prop-2-enyl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane |
|---|---|
| PubChem CID | 177446580 |
| Molecular Formula | C36H40O8Si6 |
| Molecular Weight | 769.22 g/mol |
| Exact Mass | 768.13 |
| IUPAC Name | 1,3,7,9-tetraphenyl-5,5,11,11-tetrakis(prop-2-enyl)-2,4,6,8,10,12,13,14-octaoxa-1,3,5,7,9,11-hexasilatricyclo[7.3.1.13,7]tetradecane |
| SMILES | C=CC[Si]1(CC=C)O[Si]2(c3ccccc3)O[Si](c3ccccc3)(O1)O[Si]1(c3ccccc3)O[Si](CC=C)(CC=C)O[Si](c3ccccc3)(O1)O2 |
| InChI | InChI=1S/C36H40O8Si6/c1-5-29-45(30-6-2)37-47(33-21-13-9-14-22-33)41-48(38-45,34-23-15-10-16-24-34)44-50(36-27-19-12-20-28-36)40-46(31-7-3,32-8-4)39-49(42-50,43-47)35-25-17-11-18-26-35/h5-28H,1-4,29-32H2 |
| InChIKey | RZDHTPRBJDBJNG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.22 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|