C12H10O12Si8 — CID 136734845
CID 136734845 (PubChem CID 136734845) has the molecular formula C12H10O12Si8 and a molecular weight of 570.89 g/mol.
| Compound Name | CID 136734845 |
|---|---|
| PubChem CID | 136734845 |
| Molecular Formula | C12H10O12Si8 |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 569.83 |
| IUPAC Name | — |
| SMILES | c1ccc([Si]23O[Si]4O[Si]5O[Si]6O[Si](O4)O[Si](c4ccccc4)(O[Si](O6)O[Si](O5)O2)O3)cc1 |
| InChI | InChI=1S/C12H10O12Si8/c1-3-7-11(8-4-1)31-20-27-14-25-13-26-16-29(18-27)22-32(24-31,12-9-5-2-6-10-12)23-30(17-26)19-28(15-25)21-31/h1-10H |
| InChIKey | ARWREFDWOWCQAF-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|