C12H14O3Si — CID 13219764
1-phenyl-2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decane (PubChem CID 13219764) has the molecular formula C12H14O3Si and a molecular weight of 234.33 g/mol. Its IUPAC name is 1-phenyl-2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decane.
| Compound Name | 1-phenyl-2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 13219764 |
| Molecular Formula | C12H14O3Si |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-phenyl-2,8,9-trioxa-1-silatricyclo[3.3.1.13,7]decane |
| SMILES | c1ccc([Si]23OC4CC(CC(C4)O2)O3)cc1 |
| InChI | InChI=1S/C12H14O3Si/c1-2-4-12(5-3-1)16-13-9-6-10(14-16)8-11(7-9)15-16/h1-5,9-11H,6-8H2 |
| InChIKey | ARHTVDFHEGWIGK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|