C12H18O2Si — CID 14148970
2,4,6-trimethyl-2-phenyl-1,3,2-dioxasilinane (PubChem CID 14148970) has the molecular formula C12H18O2Si and a molecular weight of 222.36 g/mol. Its IUPAC name is 2,4,6-trimethyl-2-phenyl-1,3,2-dioxasilinane.
| Compound Name | 2,4,6-trimethyl-2-phenyl-1,3,2-dioxasilinane |
|---|---|
| PubChem CID | 14148970 |
| Molecular Formula | C12H18O2Si |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 2,4,6-trimethyl-2-phenyl-1,3,2-dioxasilinane |
| SMILES | CC1CC(C)O[Si](C)(c2ccccc2)O1 |
| InChI | InChI=1S/C12H18O2Si/c1-10-9-11(2)14-15(3,13-10)12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3 |
| InChIKey | RUVFMVYUTQGDCN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|