C12H17ClSi — CID 15205261
1-chloro-2,5-dimethyl-1-phenylsilolane (PubChem CID 15205261) has the molecular formula C12H17ClSi and a molecular weight of 224.81 g/mol. Its IUPAC name is 1-chloro-2,5-dimethyl-1-phenylsilolane.
| Compound Name | 1-chloro-2,5-dimethyl-1-phenylsilolane |
|---|---|
| PubChem CID | 15205261 |
| Molecular Formula | C12H17ClSi |
| Molecular Weight | 224.81 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-chloro-2,5-dimethyl-1-phenylsilolane |
| SMILES | CC1CCC(C)[Si]1(Cl)c1ccccc1 |
| InChI | InChI=1S/C12H17ClSi/c1-10-8-9-11(2)14(10,13)12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | MFFLRVDCKOJGEQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|