C19H28OSi — CID 15526604
2,5-dimethyl-1-(6-methylcyclohexen-1-yl)oxy-1-phenylsilolane (PubChem CID 15526604) has the molecular formula C19H28OSi and a molecular weight of 300.52 g/mol. Its IUPAC name is 2,5-dimethyl-1-(6-methylcyclohexen-1-yl)oxy-1-phenylsilolane.
| Compound Name | 2,5-dimethyl-1-(6-methylcyclohexen-1-yl)oxy-1-phenylsilolane |
|---|---|
| PubChem CID | 15526604 |
| Molecular Formula | C19H28OSi |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 2,5-dimethyl-1-(6-methylcyclohexen-1-yl)oxy-1-phenylsilolane |
| SMILES | CC1CCCC=C1O[Si]1(c2ccccc2)C(C)CCC1C |
| InChI | InChI=1S/C19H28OSi/c1-15-9-7-8-12-19(15)20-21(16(2)13-14-17(21)3)18-10-5-4-6-11-18/h4-6,10-12,15-17H,7-9,13-14H2,1-3H3 |
| InChIKey | RACLHZATKMCWIY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|