C9H16 — CID 13493194
1,7-dimethylcycloheptene (PubChem CID 13493194) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is 1,7-dimethylcycloheptene.
| Compound Name | 1,7-dimethylcycloheptene |
|---|---|
| PubChem CID | 13493194 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | 1,7-dimethylcycloheptene |
| SMILES | CC1=CCCCCC1C |
| InChI | InChI=1S/C9H16/c1-8-6-4-3-5-7-9(8)2/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | TULQZTAPZBYHRY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|