C14H28 — CID 143696880
ethane;methane;1-methyl-1,2,3,3a,4,5,6,7-octahydroazulene (PubChem CID 143696880) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is ethane;methane;1-methyl-1,2,3,3a,4,5,6,7-octahydroazulene.
| Compound Name | ethane;methane;1-methyl-1,2,3,3a,4,5,6,7-octahydroazulene |
|---|---|
| PubChem CID | 143696880 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | ethane;methane;1-methyl-1,2,3,3a,4,5,6,7-octahydroazulene |
| SMILES | C.CC.CC1CCC2CCCCC=C12 |
| InChI | InChI=1S/C11H18.C2H6.CH4/c1-9-7-8-10-5-3-2-4-6-11(9)10;1-2;/h6,9-10H,2-5,7-8H2,1H3;1-2H3;1H4 |
| InChIKey | GNKHDHVJVSNVQR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|