C17H24 — CID 90750865
1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene (PubChem CID 90750865) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene.
| Compound Name | 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene |
|---|---|
| PubChem CID | 90750865 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene |
| SMILES | C1=CCC(C2CCCC=C2C2CCCCC2)=C1 |
| InChI | InChI=1S/C17H24/c1-2-8-14(9-3-1)16-12-6-7-13-17(16)15-10-4-5-11-15/h4-5,10,12,14,17H,1-3,6-9,11,13H2 |
| InChIKey | FBDCYHYLGXHKOJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|