About 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene
1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene (PubChem CID 90750865) has the molecular formula C17H24
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene.
Molecular Properties
| Compound Name | 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene |
| PubChem CID | 90750865 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene |
| SMILES | C1=CCC(C2CCCC=C2C2CCCCC2)=C1 |
| InChI | InChI=1S/C17H24/c1-2-8-14(9-3-1)16-12-6-7-13-17(16)15-10-4-5-11-15/h4-5,10,12,14,17H,1-3,6-9,11,13H2 |
| InChIKey | FBDCYHYLGXHKOJ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene?
The IUPAC name of 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene (CID 90750865) is 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene.
What is the SMILES notation for 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene?
The canonical SMILES for 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene is C1=CCC(C2CCCC=C2C2CCCCC2)=C1.
What is the InChIKey of 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene?
The InChIKey is FBDCYHYLGXHKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24/c1-2-8-14(9-3-1)16-12-6-7-13-17(16)15-10-4-5-11-15/h4-5,10,12,14,17H,1-3,6-9,11,13H2.
What are the key properties of 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene?
1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene has a molecular weight of 228.38 g/mol, XLogP of 5.18, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-6-cyclopenta-1,3-dien-1-ylcyclohexene is sourced from PubChem (CID 90750865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).