C12H20O — CID 134539334
2,3,4,5,6,7,7a,8,9,10-decahydro-1-benzoxonine (PubChem CID 134539334) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 2,3,4,5,6,7,7a,8,9,10-decahydro-1-benzoxonine.
| Compound Name | 2,3,4,5,6,7,7a,8,9,10-decahydro-1-benzoxonine |
|---|---|
| PubChem CID | 134539334 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2,3,4,5,6,7,7a,8,9,10-decahydro-1-benzoxonine |
| SMILES | C1=C2OCCCCCCC2CCC1 |
| InChI | InChI=1S/C12H20O/c1-2-6-10-13-12-9-5-4-8-11(12)7-3-1/h9,11H,1-8,10H2 |
| InChIKey | PVPJZHBGOGBWQC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |