C11H16O2 — CID 102646809
cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102646809) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 102646809 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | cyclopentyl(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)C1CCCC1 |
| InChI | InChI=1S/C11H16O2/c12-11(9-5-1-2-6-9)10-7-3-4-8-13-10/h7,9H,1-6,8H2 |
| InChIKey | GLRUTAZNDFKCLH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |