C12H19NO2 — CID 71926691
azepan-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 71926691) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is azepan-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | azepan-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 71926691 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | azepan-1-yl(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)N1CCCCCC1 |
| InChI | InChI=1S/C12H19NO2/c14-12(11-7-3-6-10-15-11)13-8-4-1-2-5-9-13/h7H,1-6,8-10H2 |
| InChIKey | MXQHAIWFBSKFDW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |