C12H10Cl2O2 — CID 102648583
(2,6-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102648583) has the molecular formula C12H10Cl2O2 and a molecular weight of 257.12 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | (2,6-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 102648583 |
| Molecular Formula | C12H10Cl2O2 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (2,6-dichlorophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | O=C(C1=CCCCO1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H10Cl2O2/c13-8-4-3-5-9(14)11(8)12(15)10-6-1-2-7-16-10/h3-6H,1-2,7H2 |
| InChIKey | TWXKHDFWNFRFKM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |