C12H13NO2 — CID 102648271
(4-aminophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone (PubChem CID 102648271) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (4-aminophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone.
| Compound Name | (4-aminophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
|---|---|
| PubChem CID | 102648271 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (4-aminophenyl)-(3,4-dihydro-2H-pyran-6-yl)methanone |
| SMILES | Nc1ccc(C(=O)C2=CCCCO2)cc1 |
| InChI | InChI=1S/C12H13NO2/c13-10-6-4-9(5-7-10)12(14)11-3-1-2-8-15-11/h3-7H,1-2,8,13H2 |
| InChIKey | VGFSQHXGBVQLAM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|