C11H18O2 — CID 172759847
2,2-dimethyl-5,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole (PubChem CID 172759847) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2,2-dimethyl-5,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole.
| Compound Name | 2,2-dimethyl-5,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole |
|---|---|
| PubChem CID | 172759847 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2,2-dimethyl-5,6,7,8,9,9a-hexahydrocycloocta[d][1,3]dioxole |
| SMILES | CC1(C)OC2=CCCCCCC2O1 |
| InChI | InChI=1S/C11H18O2/c1-11(2)12-9-7-5-3-4-6-8-10(9)13-11/h7,10H,3-6,8H2,1-2H3 |
| InChIKey | LNKOQYFWMKYGEE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |