C8H12Br2 — CID 129408234
(8R)-1,8-dibromocyclooctene (PubChem CID 129408234) has the molecular formula C8H12Br2 and a molecular weight of 267.99 g/mol. Its IUPAC name is (8R)-1,8-dibromocyclooctene.
| Compound Name | (8R)-1,8-dibromocyclooctene |
|---|---|
| PubChem CID | 129408234 |
| Molecular Formula | C8H12Br2 |
| Molecular Weight | 267.99 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | (8R)-1,8-dibromocyclooctene |
| SMILES | BrC1=CCCCCC[C@H]1Br |
| InChI | InChI=1S/C8H12Br2/c9-7-5-3-1-2-4-6-8(7)10/h5,8H,1-4,6H2/t8-/m1/s1 |
| InChIKey | WYLBUWPHMRGIJU-MRVPVSSYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.99 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|