[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate

C9H14BrNO3 — CID 131855959

IUPAC[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate
SMILESO=[N+]([O-])OC1CCCCCC/C=C/1Br
InChIInChI=1S/C9H14BrNO3/c10-8-6-4-2-1-3-5-7-9(8)14-11(12)13/h6,9H,1-5,7H2/b8-6-
InChIKeyNCSMRXMDZQDSOS-VURMDHGXSA-N
MW264.12 g/mol
LogP3.20
Rot. Bonds2

About [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate

[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate (PubChem CID 131855959) has the molecular formula C9H14BrNO3 and a molecular weight of 264.12 g/mol. Its IUPAC name is [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate.

Molecular Properties

Compound Name[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate
PubChem CID131855959
Molecular FormulaC9H14BrNO3
Molecular Weight264.12 g/mol
Exact Mass263.02
IUPAC Name[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate
SMILESO=[N+]([O-])OC1CCCCCC/C=C/1Br
InChIInChI=1S/C9H14BrNO3/c10-8-6-4-2-1-3-5-7-9(8)14-11(12)13/h6,9H,1-5,7H2/b8-6-
InChIKeyNCSMRXMDZQDSOS-VURMDHGXSA-N
XLogP3.20
TPSA52.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.12
LogP ≤ 53.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate?
The IUPAC name of [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate (CID 131855959) is [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate.
What is the SMILES notation for [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate?
The canonical SMILES for [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate is O=[N+]([O-])OC1CCCCCC/C=C/1Br.
What is the InChIKey of [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate?
The InChIKey is NCSMRXMDZQDSOS-VURMDHGXSA-N. The full InChI is InChI=1S/C9H14BrNO3/c10-8-6-4-2-1-3-5-7-9(8)14-11(12)13/h6,9H,1-5,7H2/b8-6-.
What are the key properties of [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate?
[(2Z)-2-bromocyclonon-2-en-1-yl] nitrate has a molecular weight of 264.12 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2Z)-2-bromocyclonon-2-en-1-yl] nitrate is sourced from PubChem (CID 131855959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).