C18H28 — CID 158410257
tricyclo[9.7.0.02,10]octadeca-1(18),2-diene (PubChem CID 158410257) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is tricyclo[9.7.0.02,10]octadeca-1(18),2-diene.
| Compound Name | tricyclo[9.7.0.02,10]octadeca-1(18),2-diene |
|---|---|
| PubChem CID | 158410257 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | tricyclo[9.7.0.02,10]octadeca-1(18),2-diene |
| SMILES | C1=C2C3=CCCCCCCC3C2CCCCCC1 |
| InChI | InChI=1S/C18H28/c1-3-7-11-15-16(12-8-4-1)18-14-10-6-2-5-9-13-17(15)18/h11,13,16,18H,1-10,12,14H2 |
| InChIKey | GZFIIMAYLRQKSV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |