C12H16 — CID 91699542
(8aR,8bR)-1,2,3,6,7,8,8a,8b-octahydrobiphenylene (PubChem CID 91699542) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (8aR,8bR)-1,2,3,6,7,8,8a,8b-octahydrobiphenylene.
| Compound Name | (8aR,8bR)-1,2,3,6,7,8,8a,8b-octahydrobiphenylene |
|---|---|
| PubChem CID | 91699542 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (8aR,8bR)-1,2,3,6,7,8,8a,8b-octahydrobiphenylene |
| SMILES | C1=C2C3=CCCC[C@@H]3[C@H]2CCC1 |
| InChI | InChI=1S/C12H16/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11/h5,7,10,12H,1-4,6,8H2/t10-,12+/m0/s1 |
| InChIKey | KKSNHXJCBZFMPS-CMPLNLGQSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |