C13H20O — CID 142960803
3-butyl-2,3,3a,4,5,6-hexahydroinden-1-one (PubChem CID 142960803) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 3-butyl-2,3,3a,4,5,6-hexahydroinden-1-one.
| Compound Name | 3-butyl-2,3,3a,4,5,6-hexahydroinden-1-one |
|---|---|
| PubChem CID | 142960803 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 3-butyl-2,3,3a,4,5,6-hexahydroinden-1-one |
| SMILES | CCCCC1CC(=O)C2=CCCCC21 |
| InChI | InChI=1S/C13H20O/c1-2-3-6-10-9-13(14)12-8-5-4-7-11(10)12/h8,10-11H,2-7,9H2,1H3 |
| InChIKey | IDTQSIBWYLOVPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |