C11H18O — CID 10261472
(1S,5R,7S)-7-butyl-7-deuteriobicyclo[3.2.0]heptan-6-one (PubChem CID 10261472) has the molecular formula C11H18O and a molecular weight of 167.27 g/mol. Its IUPAC name is (1S,5R,7S)-7-butyl-7-deuteriobicyclo[3.2.0]heptan-6-one.
| Compound Name | (1S,5R,7S)-7-butyl-7-deuteriobicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 10261472 |
| Molecular Formula | C11H18O |
| Molecular Weight | 167.27 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | (1S,5R,7S)-7-butyl-7-deuteriobicyclo[3.2.0]heptan-6-one |
| SMILES | [2H][C@@]1(CCCC)C(=O)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C11H18O/c1-2-3-5-9-8-6-4-7-10(8)11(9)12/h8-10H,2-7H2,1H3/t8-,9+,10-/m1/s1/i9D |
| InChIKey | OFCHFXAOYRDKMA-WHGNJFEMSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |