C12H22O — CID 12712312
trans-(2S,6S)-2,6-dipropylcyclohexan-1-one (PubChem CID 12712312) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is trans-(2S,6S)-2,6-dipropylcyclohexan-1-one.
| Compound Name | trans-(2S,6S)-2,6-dipropylcyclohexan-1-one |
|---|---|
| PubChem CID | 12712312 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | trans-(2S,6S)-2,6-dipropylcyclohexan-1-one |
| SMILES | CCC[C@H]1CCC[C@H](CCC)C1=O |
| InChI | InChI=1S/C12H22O/c1-3-6-10-8-5-9-11(7-4-2)12(10)13/h10-11H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | FKMXHIJXLXXLNZ-QWRGUYRKSA-N |
| XLogP | 3.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |