C11H20 — CID 143703597
(3R)-1,2-dimethyl-3-propylcyclohexene (PubChem CID 143703597) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is (3R)-1,2-dimethyl-3-propylcyclohexene.
| Compound Name | (3R)-1,2-dimethyl-3-propylcyclohexene |
|---|---|
| PubChem CID | 143703597 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | (3R)-1,2-dimethyl-3-propylcyclohexene |
| SMILES | CCC[C@@H]1CCCC(C)=C1C |
| InChI | InChI=1S/C11H20/c1-4-6-11-8-5-7-9(2)10(11)3/h11H,4-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | JNXQLQRHYVYAPA-LLVKDONJSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|