About (1S)-2,3-dimethylcyclohex-2-en-1-amine
(1S)-2,3-dimethylcyclohex-2-en-1-amine (PubChem CID 129374983) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is (1S)-2,3-dimethylcyclohex-2-en-1-amine.
Molecular Properties
| Compound Name | (1S)-2,3-dimethylcyclohex-2-en-1-amine |
| PubChem CID | 129374983 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1S)-2,3-dimethylcyclohex-2-en-1-amine |
| SMILES | CC1=C(C)[C@@H](N)CCC1 |
| InChI | InChI=1S/C8H15N/c1-6-4-3-5-8(9)7(6)2/h8H,3-5,9H2,1-2H3/t8-/m0/s1 |
| InChIKey | RZTQSJOBCGCLHV-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2,3-dimethylcyclohex-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,3-dimethylcyclohex-2-en-1-amine?
The IUPAC name of (1S)-2,3-dimethylcyclohex-2-en-1-amine (CID 129374983) is (1S)-2,3-dimethylcyclohex-2-en-1-amine.
What is the SMILES notation for (1S)-2,3-dimethylcyclohex-2-en-1-amine?
The canonical SMILES for (1S)-2,3-dimethylcyclohex-2-en-1-amine is CC1=C(C)[C@@H](N)CCC1.
What is the InChIKey of (1S)-2,3-dimethylcyclohex-2-en-1-amine?
The InChIKey is RZTQSJOBCGCLHV-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H15N/c1-6-4-3-5-8(9)7(6)2/h8H,3-5,9H2,1-2H3/t8-/m0/s1.
What are the key properties of (1S)-2,3-dimethylcyclohex-2-en-1-amine?
(1S)-2,3-dimethylcyclohex-2-en-1-amine has a molecular weight of 125.21 g/mol, XLogP of 1.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,3-dimethylcyclohex-2-en-1-amine is sourced from PubChem (CID 129374983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).