C8H15N — CID 129374983
(1S)-2,3-dimethylcyclohex-2-en-1-amine (PubChem CID 129374983) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is (1S)-2,3-dimethylcyclohex-2-en-1-amine.
| Compound Name | (1S)-2,3-dimethylcyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 129374983 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (1S)-2,3-dimethylcyclohex-2-en-1-amine |
| SMILES | CC1=C(C)[C@@H](N)CCC1 |
| InChI | InChI=1S/C8H15N/c1-6-4-3-5-8(9)7(6)2/h8H,3-5,9H2,1-2H3/t8-/m0/s1 |
| InChIKey | RZTQSJOBCGCLHV-QMMMGPOBSA-N |
| XLogP | 1.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|