C11H16N2 — CID 55273686
(1R)-7-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine (PubChem CID 55273686) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is (1R)-7-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine.
| Compound Name | (1R)-7-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
|---|---|
| PubChem CID | 55273686 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | (1R)-7-methyl-1,2,3,4-tetrahydronaphthalene-1,6-diamine |
| SMILES | Cc1cc2c(cc1N)CCC[C@H]2N |
| InChI | InChI=1S/C11H16N2/c1-7-5-9-8(6-11(7)13)3-2-4-10(9)12/h5-6,10H,2-4,12-13H2,1H3/t10-/m1/s1 |
| InChIKey | GSTLCKUZPUXHBC-SNVBAGLBSA-N |
| XLogP | 1.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|