C12H25NO — CID 142832995
6-amino-2,3-dimethylcyclohex-2-en-1-one;ethane (PubChem CID 142832995) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 6-amino-2,3-dimethylcyclohex-2-en-1-one;ethane.
| Compound Name | 6-amino-2,3-dimethylcyclohex-2-en-1-one;ethane |
|---|---|
| PubChem CID | 142832995 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 6-amino-2,3-dimethylcyclohex-2-en-1-one;ethane |
| SMILES | CC.CC.CC1=C(C)C(=O)C(N)CC1 |
| InChI | InChI=1S/C8H13NO.2C2H6/c1-5-3-4-7(9)8(10)6(5)2;2*1-2/h7H,3-4,9H2,1-2H3;2*1-2H3 |
| InChIKey | ODQUMOSXCQYYHO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |