C10H9Cl2NO — CID 14976596
2-amino-6,7-dichloro-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 14976596) has the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. Its IUPAC name is 2-amino-6,7-dichloro-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 2-amino-6,7-dichloro-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 14976596 |
| Molecular Formula | C10H9Cl2NO |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 2-amino-6,7-dichloro-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | NC1CCc2cc(Cl)c(Cl)cc2C1=O |
| InChI | InChI=1S/C10H9Cl2NO/c11-7-3-5-1-2-9(13)10(14)6(5)4-8(7)12/h3-4,9H,1-2,13H2 |
| InChIKey | UVCAGRNUEVAPAJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |