2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid

C11H10Cl2O2 — CID 123427549

IUPAC2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid
SMILESO=C(O)CC1CCc2cc(Cl)c(Cl)cc21
InChIInChI=1S/C11H10Cl2O2/c12-9-3-6-1-2-7(4-11(14)15)8(6)5-10(9)13/h3,5,7H,1-2,4H2,(H,14,15)
InChIKeyCHEUEGCXWFTNLJ-UHFFFAOYSA-N
MW245.10 g/mol
LogP3.50
Rot. Bonds2

About 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid

2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid (PubChem CID 123427549) has the molecular formula C11H10Cl2O2 and a molecular weight of 245.10 g/mol. Its IUPAC name is 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid.

Molecular Properties

Compound Name2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid
PubChem CID123427549
Molecular FormulaC11H10Cl2O2
Molecular Weight245.10 g/mol
Exact Mass244.01
IUPAC Name2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid
SMILESO=C(O)CC1CCc2cc(Cl)c(Cl)cc21
InChIInChI=1S/C11H10Cl2O2/c12-9-3-6-1-2-7(4-11(14)15)8(6)5-10(9)13/h3,5,7H,1-2,4H2,(H,14,15)
InChIKeyCHEUEGCXWFTNLJ-UHFFFAOYSA-N
XLogP3.50
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500245.10
LogP ≤ 53.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid?
The IUPAC name of 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid (CID 123427549) is 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid.
What is the SMILES notation for 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid?
The canonical SMILES for 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid is O=C(O)CC1CCc2cc(Cl)c(Cl)cc21.
What is the InChIKey of 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid?
The InChIKey is CHEUEGCXWFTNLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O2/c12-9-3-6-1-2-7(4-11(14)15)8(6)5-10(9)13/h3,5,7H,1-2,4H2,(H,14,15).
What are the key properties of 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid?
2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid has a molecular weight of 245.10 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dichloro-2,3-dihydro-1H-inden-1-yl)acetic acid is sourced from PubChem (CID 123427549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).