2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid

C9H10O2S — CID 83906666

IUPAC2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid
SMILESO=C(O)CC1CCc2cscc21
InChIInChI=1S/C9H10O2S/c10-9(11)3-6-1-2-7-4-12-5-8(6)7/h4-6H,1-3H2,(H,10,11)
InChIKeyFHWXYCZZPQPJMV-UHFFFAOYSA-N
MW182.24 g/mol
LogP2.25
Rot. Bonds2

About 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid

2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid (PubChem CID 83906666) has the molecular formula C9H10O2S and a molecular weight of 182.24 g/mol. Its IUPAC name is 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid.

Molecular Properties

Compound Name2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid
PubChem CID83906666
Molecular FormulaC9H10O2S
Molecular Weight182.24 g/mol
Exact Mass182.04
IUPAC Name2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid
SMILESO=C(O)CC1CCc2cscc21
InChIInChI=1S/C9H10O2S/c10-9(11)3-6-1-2-7-4-12-5-8(6)7/h4-6H,1-3H2,(H,10,11)
InChIKeyFHWXYCZZPQPJMV-UHFFFAOYSA-N
XLogP2.25
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.24
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid?
The IUPAC name of 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid (CID 83906666) is 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid.
What is the SMILES notation for 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid?
The canonical SMILES for 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid is O=C(O)CC1CCc2cscc21.
What is the InChIKey of 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid?
The InChIKey is FHWXYCZZPQPJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2S/c10-9(11)3-6-1-2-7-4-12-5-8(6)7/h4-6H,1-3H2,(H,10,11).
What are the key properties of 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid?
2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid has a molecular weight of 182.24 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dihydro-4H-cyclopenta[c]thiophen-4-yl)acetic acid is sourced from PubChem (CID 83906666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).