About 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid
2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid (PubChem CID 67720113) has the molecular formula C11H10BrFO3
and a molecular weight of 289.10 g/mol. Its IUPAC name is 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid |
| PubChem CID | 67720113 |
| Molecular Formula | C11H10BrFO3 |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid |
| SMILES | O=C(O)CC1CCc2c(Br)cc(OF)cc21 |
| InChI | InChI=1S/C11H10BrFO3/c12-10-5-7(16-13)4-9-6(3-11(14)15)1-2-8(9)10/h4-6H,1-3H2,(H,14,15) |
| InChIKey | HAGGFWQDJXCPKB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid?
The IUPAC name of 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid (CID 67720113) is 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid.
What is the SMILES notation for 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid?
The canonical SMILES for 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid is O=C(O)CC1CCc2c(Br)cc(OF)cc21.
What is the InChIKey of 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid?
The InChIKey is HAGGFWQDJXCPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFO3/c12-10-5-7(16-13)4-9-6(3-11(14)15)1-2-8(9)10/h4-6H,1-3H2,(H,14,15).
What are the key properties of 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid?
2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid has a molecular weight of 289.10 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-6-fluorooxy-2,3-dihydro-1H-inden-1-yl)acetic acid is sourced from PubChem (CID 67720113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).