2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid

C10H12O2S — CID 83907980

IUPAC2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid
SMILESCc1cc2c(s1)CCC2CC(=O)O
InChIInChI=1S/C10H12O2S/c1-6-4-8-7(5-10(11)12)2-3-9(8)13-6/h4,7H,2-3,5H2,1H3,(H,11,12)
InChIKeyOMWGWANTGVFUFO-UHFFFAOYSA-N
MW196.27 g/mol
LogP2.56
Rot. Bonds2

About 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid

2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid (PubChem CID 83907980) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid
PubChem CID83907980
Molecular FormulaC10H12O2S
Molecular Weight196.27 g/mol
Exact Mass196.06
IUPAC Name2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid
SMILESCc1cc2c(s1)CCC2CC(=O)O
InChIInChI=1S/C10H12O2S/c1-6-4-8-7(5-10(11)12)2-3-9(8)13-6/h4,7H,2-3,5H2,1H3,(H,11,12)
InChIKeyOMWGWANTGVFUFO-UHFFFAOYSA-N
XLogP2.56
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.27
LogP ≤ 52.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid?
The IUPAC name of 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid (CID 83907980) is 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid.
What is the SMILES notation for 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid?
The canonical SMILES for 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid is Cc1cc2c(s1)CCC2CC(=O)O.
What is the InChIKey of 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid?
The InChIKey is OMWGWANTGVFUFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2S/c1-6-4-8-7(5-10(11)12)2-3-9(8)13-6/h4,7H,2-3,5H2,1H3,(H,11,12).
What are the key properties of 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid?
2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid has a molecular weight of 196.27 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetic acid is sourced from PubChem (CID 83907980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).