About 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid
2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid (PubChem CID 82414343) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid.
Analyze 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid?
The IUPAC name of 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid (CID 82414343) is 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid.
What is the SMILES notation for 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid?
The canonical SMILES for 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid is O=C(O)CC1CCc2[nH]ncc21.
What is the InChIKey of 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid?
The InChIKey is ZVKGSBDFILFJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c11-8(12)3-5-1-2-7-6(5)4-9-10-7/h4-5H,1-3H2,(H,9,10)(H,11,12).
What are the key properties of 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid?
2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid has a molecular weight of 166.18 g/mol, XLogP of 0.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-4-yl)acetic acid is sourced from PubChem (CID 82414343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).