About 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid
6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 82027298) has the molecular formula C11H10Cl2O2
and a molecular weight of 245.10 g/mol. Its IUPAC name is 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid.
Analyze 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The IUPAC name of 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid (CID 82027298) is 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid.
What is the SMILES notation for 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The canonical SMILES for 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid is O=C(O)C1CCCc2cc(Cl)c(Cl)cc21.
What is the InChIKey of 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The InChIKey is VTFVNCZEQFBIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Cl2O2/c12-9-4-6-2-1-3-7(11(14)15)8(6)5-10(9)13/h4-5,7H,1-3H2,(H,14,15).
What are the key properties of 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid has a molecular weight of 245.10 g/mol, XLogP of 3.50, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dichloro-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid is sourced from PubChem (CID 82027298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).