6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid

C15H20O4 — CID 82027305

IUPAC6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid
SMILESCCOc1cc2c(cc1OCC)C(C(=O)O)CCC2
InChIInChI=1S/C15H20O4/c1-3-18-13-8-10-6-5-7-11(15(16)17)12(10)9-14(13)19-4-2/h8-9,11H,3-7H2,1-2H3,(H,16,17)
InChIKeyRBVWLAOLDNWGET-UHFFFAOYSA-N
MW264.32 g/mol
LogP2.99
Rot. Bonds5

About 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid

6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 82027305) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid.

Molecular Properties

Compound Name6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid
PubChem CID82027305
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid
SMILESCCOc1cc2c(cc1OCC)C(C(=O)O)CCC2
InChIInChI=1S/C15H20O4/c1-3-18-13-8-10-6-5-7-11(15(16)17)12(10)9-14(13)19-4-2/h8-9,11H,3-7H2,1-2H3,(H,16,17)
InChIKeyRBVWLAOLDNWGET-UHFFFAOYSA-N
XLogP2.99
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The IUPAC name of 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid (CID 82027305) is 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid.
What is the SMILES notation for 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The canonical SMILES for 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid is CCOc1cc2c(cc1OCC)C(C(=O)O)CCC2.
What is the InChIKey of 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
The InChIKey is RBVWLAOLDNWGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-3-18-13-8-10-6-5-7-11(15(16)17)12(10)9-14(13)19-4-2/h8-9,11H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid?
6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid has a molecular weight of 264.32 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-diethoxy-1,2,3,4-tetrahydronaphthalene-1-carboxylic acid is sourced from PubChem (CID 82027305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).