C16H18O2 — CID 143073531
2,7-dimethyl-2,3,4,5,6,7-hexahydroanthracene-1,8-dione (PubChem CID 143073531) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2,7-dimethyl-2,3,4,5,6,7-hexahydroanthracene-1,8-dione.
| Compound Name | 2,7-dimethyl-2,3,4,5,6,7-hexahydroanthracene-1,8-dione |
|---|---|
| PubChem CID | 143073531 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2,7-dimethyl-2,3,4,5,6,7-hexahydroanthracene-1,8-dione |
| SMILES | CC1CCc2cc3c(cc2C1=O)C(=O)C(C)CC3 |
| InChI | InChI=1S/C16H18O2/c1-9-3-5-11-7-12-6-4-10(2)16(18)14(12)8-13(11)15(9)17/h7-10H,3-6H2,1-2H3 |
| InChIKey | RXJMMELSESDNDA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |