C20H20O2 — CID 6977247
(2S,8R)-2,8-dimethyl-2,3,4,8,9,10-hexahydrochrysene-1,7-dione (PubChem CID 6977247) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S,8R)-2,8-dimethyl-2,3,4,8,9,10-hexahydrochrysene-1,7-dione.
| Compound Name | (2S,8R)-2,8-dimethyl-2,3,4,8,9,10-hexahydrochrysene-1,7-dione |
|---|---|
| PubChem CID | 6977247 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2S,8R)-2,8-dimethyl-2,3,4,8,9,10-hexahydrochrysene-1,7-dione |
| SMILES | C[C@@H]1CCc2c(ccc3c4c(ccc23)C(=O)[C@@H](C)CC4)C1=O |
| InChI | InChI=1S/C20H20O2/c1-11-3-5-15-13-8-10-18-16(6-4-12(2)20(18)22)14(13)7-9-17(15)19(11)21/h7-12H,3-6H2,1-2H3/t11-,12+ |
| InChIKey | FSPIKCDLHIIDOY-TXEJJXNPSA-N |
| XLogP | 4.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |