C11H11ClO2 — CID 146510847
(2S)-4-chloro-5-methoxy-2-methyl-2,3-dihydroinden-1-one (PubChem CID 146510847) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is (2S)-4-chloro-5-methoxy-2-methyl-2,3-dihydroinden-1-one.
| Compound Name | (2S)-4-chloro-5-methoxy-2-methyl-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 146510847 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (2S)-4-chloro-5-methoxy-2-methyl-2,3-dihydroinden-1-one |
| SMILES | COc1ccc2c(c1Cl)C[C@H](C)C2=O |
| InChI | InChI=1S/C11H11ClO2/c1-6-5-8-7(11(6)13)3-4-9(14-2)10(8)12/h3-4,6H,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | RWUFVEXALAOQEO-LURJTMIESA-N |
| XLogP | 2.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |