C15H18O4 — CID 22173121
tert-butyl (2-methyl-1-oxo-2,3-dihydroinden-4-yl) carbonate (PubChem CID 22173121) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl (2-methyl-1-oxo-2,3-dihydroinden-4-yl) carbonate.
| Compound Name | tert-butyl (2-methyl-1-oxo-2,3-dihydroinden-4-yl) carbonate |
|---|---|
| PubChem CID | 22173121 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | tert-butyl (2-methyl-1-oxo-2,3-dihydroinden-4-yl) carbonate |
| SMILES | CC1Cc2c(OC(=O)OC(C)(C)C)cccc2C1=O |
| InChI | InChI=1S/C15H18O4/c1-9-8-11-10(13(9)16)6-5-7-12(11)18-14(17)19-15(2,3)4/h5-7,9H,8H2,1-4H3 |
| InChIKey | JXQXOERCMVVVNQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|