C12H15BrO — CID 143769124
4-bromo-2-methyl-2,3-dihydroinden-1-one;ethane (PubChem CID 143769124) has the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. Its IUPAC name is 4-bromo-2-methyl-2,3-dihydroinden-1-one;ethane.
| Compound Name | 4-bromo-2-methyl-2,3-dihydroinden-1-one;ethane |
|---|---|
| PubChem CID | 143769124 |
| Molecular Formula | C12H15BrO |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 4-bromo-2-methyl-2,3-dihydroinden-1-one;ethane |
| SMILES | CC.CC1Cc2c(Br)cccc2C1=O |
| InChI | InChI=1S/C10H9BrO.C2H6/c1-6-5-8-7(10(6)12)3-2-4-9(8)11;1-2/h2-4,6H,5H2,1H3;1-2H3 |
| InChIKey | KYEBCBAZMMPVBP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |