C15H14O4S — CID 24975192
methyl 1-oxo-3,4-dihydro-2H-phenanthrene-2-sulfonate (PubChem CID 24975192) has the molecular formula C15H14O4S and a molecular weight of 290.34 g/mol. Its IUPAC name is methyl 1-oxo-3,4-dihydro-2H-phenanthrene-2-sulfonate.
| Compound Name | methyl 1-oxo-3,4-dihydro-2H-phenanthrene-2-sulfonate |
|---|---|
| PubChem CID | 24975192 |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | methyl 1-oxo-3,4-dihydro-2H-phenanthrene-2-sulfonate |
| SMILES | COS(=O)(=O)C1CCc2c(ccc3ccccc23)C1=O |
| InChI | InChI=1S/C15H14O4S/c1-19-20(17,18)14-9-8-12-11-5-3-2-4-10(11)6-7-13(12)15(14)16/h2-7,14H,8-9H2,1H3 |
| InChIKey | YJPGMBOPINEWLV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|