C15H15ClO — CID 141017293
2-methyl-3,4-dihydro-2H-phenanthren-1-one;hydrochloride (PubChem CID 141017293) has the molecular formula C15H15ClO and a molecular weight of 246.74 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-phenanthren-1-one;hydrochloride.
| Compound Name | 2-methyl-3,4-dihydro-2H-phenanthren-1-one;hydrochloride |
|---|---|
| PubChem CID | 141017293 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-phenanthren-1-one;hydrochloride |
| SMILES | CC1CCc2c(ccc3ccccc23)C1=O.Cl |
| InChI | InChI=1S/C15H14O.ClH/c1-10-6-8-13-12-5-3-2-4-11(12)7-9-14(13)15(10)16;/h2-5,7,9-10H,6,8H2,1H3;1H |
| InChIKey | IQCOQDCBXVRDMX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |