C15H14O — CID 14940541
(3R)-3-methyl-2,3-dihydro-1H-phenanthren-4-one (PubChem CID 14940541) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (3R)-3-methyl-2,3-dihydro-1H-phenanthren-4-one.
| Compound Name | (3R)-3-methyl-2,3-dihydro-1H-phenanthren-4-one |
|---|---|
| PubChem CID | 14940541 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (3R)-3-methyl-2,3-dihydro-1H-phenanthren-4-one |
| SMILES | C[C@@H]1CCc2ccc3ccccc3c2C1=O |
| InChI | InChI=1S/C15H14O/c1-10-6-7-12-9-8-11-4-2-3-5-13(11)14(12)15(10)16/h2-5,8-10H,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | APJCTGMMBSJFAU-SNVBAGLBSA-N |
| XLogP | 3.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |