C18H14OS — CID 102581784
3-methyl-5-thiatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-7-one (PubChem CID 102581784) has the molecular formula C18H14OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 3-methyl-5-thiatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-7-one.
| Compound Name | 3-methyl-5-thiatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-7-one |
|---|---|
| PubChem CID | 102581784 |
| Molecular Formula | C18H14OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-methyl-5-thiatetracyclo[8.8.0.02,6.011,16]octadeca-1(10),2(6),3,11,13,15,17-heptaen-7-one |
| SMILES | Cc1csc2c1-c1ccc3ccccc3c1CCC2=O |
| InChI | InChI=1S/C18H14OS/c1-11-10-20-18-16(19)9-8-14-13-5-3-2-4-12(13)6-7-15(14)17(11)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | KCDFIHNSLCCSHI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |